About [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol
[3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol (PubChem CID 23723805) has the molecular formula C22H28ClNO3
and a molecular weight of 389.92 g/mol. Its IUPAC name is [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol |
| PubChem CID | 23723805 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol |
| SMILES | COc1cc(Cl)c(CN2CCCC(CO)(Cc3ccccc3)C2)cc1OC |
| InChI | InChI=1S/C22H28ClNO3/c1-26-20-11-18(19(23)12-21(20)27-2)14-24-10-6-9-22(15-24,16-25)13-17-7-4-3-5-8-17/h3-5,7-8,11-12,25H,6,9-10,13-16H2,1-2H3 |
| InChIKey | HKARJZCBZDESBG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol?
The IUPAC name of [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol (CID 23723805) is [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol.
What is the SMILES notation for [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol?
The canonical SMILES for [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol is COc1cc(Cl)c(CN2CCCC(CO)(Cc3ccccc3)C2)cc1OC.
What is the InChIKey of [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol?
The InChIKey is HKARJZCBZDESBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28ClNO3/c1-26-20-11-18(19(23)12-21(20)27-2)14-24-10-6-9-22(15-24,16-25)13-17-7-4-3-5-8-17/h3-5,7-8,11-12,25H,6,9-10,13-16H2,1-2H3.
What are the key properties of [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol?
[3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol has a molecular weight of 389.92 g/mol, XLogP of 4.17, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-benzyl-1-[(2-chloro-4,5-dimethoxyphenyl)methyl]piperidin-3-yl]methanol is sourced from PubChem (CID 23723805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).