About N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide
N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide (PubChem CID 23723826) has the molecular formula C21H32FN3O2
and a molecular weight of 377.50 g/mol. Its IUPAC name is N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide.
Molecular Properties
| Compound Name | N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide |
| PubChem CID | 23723826 |
| Molecular Formula | C21H32FN3O2 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide |
| SMILES | CN(C)C(=O)CCC(=O)N(C)CC1CCCN(CCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H32FN3O2/c1-23(2)20(26)10-11-21(27)24(3)15-18-5-4-13-25(16-18)14-12-17-6-8-19(22)9-7-17/h6-9,18H,4-5,10-16H2,1-3H3 |
| InChIKey | PRLJBNYWQPEDCG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide?
The IUPAC name of N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide (CID 23723826) is N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide.
What is the SMILES notation for N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide?
The canonical SMILES for N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide is CN(C)C(=O)CCC(=O)N(C)CC1CCCN(CCc2ccc(F)cc2)C1.
What is the InChIKey of N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide?
The InChIKey is PRLJBNYWQPEDCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32FN3O2/c1-23(2)20(26)10-11-21(27)24(3)15-18-5-4-13-25(16-18)14-12-17-6-8-19(22)9-7-17/h6-9,18H,4-5,10-16H2,1-3H3.
What are the key properties of N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide?
N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide has a molecular weight of 377.50 g/mol, XLogP of 2.41, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[1-[2-(4-fluorophenyl)ethyl]piperidin-3-yl]methyl]-N,N,N'-trimethylbutanediamide is sourced from PubChem (CID 23723826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).