C21H32N2O3 — CID 23723921
N-[(1-cyclohexylpiperidin-3-yl)methyl]-2,3-dimethoxybenzamide (PubChem CID 23723921) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[(1-cyclohexylpiperidin-3-yl)methyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[(1-cyclohexylpiperidin-3-yl)methyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 23723921 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | N-[(1-cyclohexylpiperidin-3-yl)methyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)NCC2CCCN(C3CCCCC3)C2)c1OC |
| InChI | InChI=1S/C21H32N2O3/c1-25-19-12-6-11-18(20(19)26-2)21(24)22-14-16-8-7-13-23(15-16)17-9-4-3-5-10-17/h6,11-12,16-17H,3-5,7-10,13-15H2,1-2H3,(H,22,24) |
| InChIKey | MNAVCEKGMZSNSS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |