C24H29N3O2 — CID 23723998
2-[[3-(2-hydroxyethyl)-4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-1H-quinolin-4-one (PubChem CID 23723998) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-[[3-(2-hydroxyethyl)-4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-1H-quinolin-4-one.
| Compound Name | 2-[[3-(2-hydroxyethyl)-4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 23723998 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2-[[3-(2-hydroxyethyl)-4-[(2-methylphenyl)methyl]piperazin-1-yl]methyl]-1H-quinolin-4-one |
| SMILES | Cc1ccccc1CN1CCN(Cc2cc(=O)c3ccccc3[nH]2)CC1CCO |
| InChI | InChI=1S/C24H29N3O2/c1-18-6-2-3-7-19(18)15-27-12-11-26(17-21(27)10-13-28)16-20-14-24(29)22-8-4-5-9-23(22)25-20/h2-9,14,21,28H,10-13,15-17H2,1H3,(H,25,29) |
| InChIKey | RGMIXGGFKWQJFR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |