About 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine
4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine (PubChem CID 23724042) has the molecular formula C17H25ClN2O3S
and a molecular weight of 372.92 g/mol. Its IUPAC name is 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine.
Molecular Properties
| Compound Name | 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine |
| PubChem CID | 23724042 |
| Molecular Formula | C17H25ClN2O3S |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine |
| SMILES | Cc1cc(S(=O)(=O)N2CCCC(N3CCOCC3)C2)c(C)cc1Cl |
| InChI | InChI=1S/C17H25ClN2O3S/c1-13-11-17(14(2)10-16(13)18)24(21,22)20-5-3-4-15(12-20)19-6-8-23-9-7-19/h10-11,15H,3-9,12H2,1-2H3 |
| InChIKey | YYWJZICIONOXNA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine?
The IUPAC name of 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine (CID 23724042) is 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine.
What is the SMILES notation for 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine?
The canonical SMILES for 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine is Cc1cc(S(=O)(=O)N2CCCC(N3CCOCC3)C2)c(C)cc1Cl.
What is the InChIKey of 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine?
The InChIKey is YYWJZICIONOXNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25ClN2O3S/c1-13-11-17(14(2)10-16(13)18)24(21,22)20-5-3-4-15(12-20)19-6-8-23-9-7-19/h10-11,15H,3-9,12H2,1-2H3.
What are the key properties of 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine?
4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine has a molecular weight of 372.92 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-chloro-2,5-dimethylphenyl)sulfonylpiperidin-3-yl]morpholine is sourced from PubChem (CID 23724042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).