C21H18Cl3N5O3S — CID 23724091
3-[5,6-dichloro-2-[2-[[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]amino]ethyl]benzimidazol-1-yl]propan-1-ol (PubChem CID 23724091) has the molecular formula C21H18Cl3N5O3S and a molecular weight of 526.83 g/mol. Its IUPAC name is 3-[5,6-dichloro-2-[2-[[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]amino]ethyl]benzimidazol-1-yl]propan-1-ol.
| Compound Name | 3-[5,6-dichloro-2-[2-[[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]amino]ethyl]benzimidazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 23724091 |
| Molecular Formula | C21H18Cl3N5O3S |
| Molecular Weight | 526.83 g/mol |
| Exact Mass | 525.02 |
| IUPAC Name | 3-[5,6-dichloro-2-[2-[[4-(4-chloro-3-nitrophenyl)-1,3-thiazol-2-yl]amino]ethyl]benzimidazol-1-yl]propan-1-ol |
| SMILES | O=[N+]([O-])c1cc(-c2csc(NCCc3nc4cc(Cl)c(Cl)cc4n3CCCO)n2)ccc1Cl |
| InChI | InChI=1S/C21H18Cl3N5O3S/c22-13-3-2-12(8-18(13)29(31)32)17-11-33-21(27-17)25-5-4-20-26-16-9-14(23)15(24)10-19(16)28(20)6-1-7-30/h2-3,8-11,30H,1,4-7H2,(H,25,27) |
| InChIKey | LVYXSKJGKIYYTN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 106.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.83 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|