C20H35N3O6 — CID 23724179
3-butoxy-N-[[1-(2-morpholin-4-ylethyl)pyrrol-2-yl]methyl]propan-1-amine;oxalic acid (PubChem CID 23724179) has the molecular formula C20H35N3O6 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-butoxy-N-[[1-(2-morpholin-4-ylethyl)pyrrol-2-yl]methyl]propan-1-amine;oxalic acid.
| Compound Name | 3-butoxy-N-[[1-(2-morpholin-4-ylethyl)pyrrol-2-yl]methyl]propan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 23724179 |
| Molecular Formula | C20H35N3O6 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 3-butoxy-N-[[1-(2-morpholin-4-ylethyl)pyrrol-2-yl]methyl]propan-1-amine;oxalic acid |
| SMILES | CCCCOCCCNCc1cccn1CCN1CCOCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H33N3O2.C2H2O4/c1-2-3-13-22-14-5-7-19-17-18-6-4-8-21(18)10-9-20-11-15-23-16-12-20;3-1(4)2(5)6/h4,6,8,19H,2-3,5,7,9-17H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | TXHOQJVVICJCJA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|