C14H18ClN3OS — CID 23724219
N-[5-(2-phenylethyl)-1,3,4-thiadiazol-2-yl]butanamide;hydrochloride (PubChem CID 23724219) has the molecular formula C14H18ClN3OS and a molecular weight of 311.84 g/mol. Its IUPAC name is N-[5-(2-phenylethyl)-1,3,4-thiadiazol-2-yl]butanamide;hydrochloride.
| Compound Name | N-[5-(2-phenylethyl)-1,3,4-thiadiazol-2-yl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 23724219 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[5-(2-phenylethyl)-1,3,4-thiadiazol-2-yl]butanamide;hydrochloride |
| SMILES | CCCC(=O)Nc1nnc(CCc2ccccc2)s1.Cl |
| InChI | InChI=1S/C14H17N3OS.ClH/c1-2-6-12(18)15-14-17-16-13(19-14)10-9-11-7-4-3-5-8-11;/h3-5,7-8H,2,6,9-10H2,1H3,(H,15,17,18);1H |
| InChIKey | GCVNUSLGYVBOFV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |