About N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride
N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride (PubChem CID 23724220) has the molecular formula C8H6ClN3O3S2
and a molecular weight of 291.74 g/mol. Its IUPAC name is N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride |
| PubChem CID | 23724220 |
| Molecular Formula | C8H6ClN3O3S2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 290.95 |
| IUPAC Name | N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ncc([N+](=O)[O-])s1)c1cccs1 |
| InChI | InChI=1S/C8H5N3O3S2.ClH/c12-7(5-2-1-3-15-5)10-8-9-4-6(16-8)11(13)14;/h1-4H,(H,9,10,12);1H |
| InChIKey | MOMYNTLFJILYDI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride?
The IUPAC name of N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride (CID 23724220) is N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride.
What is the SMILES notation for N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride?
The canonical SMILES for N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride is Cl.O=C(Nc1ncc([N+](=O)[O-])s1)c1cccs1.
What is the InChIKey of N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride?
The InChIKey is MOMYNTLFJILYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O3S2.ClH/c12-7(5-2-1-3-15-5)10-8-9-4-6(16-8)11(13)14;/h1-4H,(H,9,10,12);1H.
What are the key properties of N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride?
N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride has a molecular weight of 291.74 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide;hydrochloride is sourced from PubChem (CID 23724220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).