About 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride
3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride (PubChem CID 23724245) has the molecular formula C16H25ClN2O2
and a molecular weight of 312.84 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride.
Molecular Properties
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride |
| PubChem CID | 23724245 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride |
| SMILES | Cc1ccc(NC(=O)CCN2CC(C)OC(C)C2)cc1.Cl |
| InChI | InChI=1S/C16H24N2O2.ClH/c1-12-4-6-15(7-5-12)17-16(19)8-9-18-10-13(2)20-14(3)11-18;/h4-7,13-14H,8-11H2,1-3H3,(H,17,19);1H |
| InChIKey | BVLJNJFEBJPCKB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride?
The IUPAC name of 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride (CID 23724245) is 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride.
What is the SMILES notation for 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride?
The canonical SMILES for 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride is Cc1ccc(NC(=O)CCN2CC(C)OC(C)C2)cc1.Cl.
What is the InChIKey of 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride?
The InChIKey is BVLJNJFEBJPCKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2.ClH/c1-12-4-6-15(7-5-12)17-16(19)8-9-18-10-13(2)20-14(3)11-18;/h4-7,13-14H,8-11H2,1-3H3,(H,17,19);1H.
What are the key properties of 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride?
3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride has a molecular weight of 312.84 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylmorpholin-4-yl)-N-(4-methylphenyl)propanamide;hydrochloride is sourced from PubChem (CID 23724245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).