About N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid
N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid (PubChem CID 23724255) has the molecular formula C19H23NO6
and a molecular weight of 361.39 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid.
Molecular Properties
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid |
| PubChem CID | 23724255 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid |
| SMILES | COc1ccc(CNCc2ccc(C)cc2)c(OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H21NO2.C2H2O4/c1-13-4-6-14(7-5-13)11-18-12-15-8-9-16(19-2)10-17(15)20-3;3-1(4)2(5)6/h4-10,18H,11-12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | VNOOJQRZJKULQR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid?
The IUPAC name of N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid (CID 23724255) is N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid.
What is the SMILES notation for N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid?
The canonical SMILES for N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid is COc1ccc(CNCc2ccc(C)cc2)c(OC)c1.O=C(O)C(=O)O.
What is the InChIKey of N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid?
The InChIKey is VNOOJQRZJKULQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO2.C2H2O4/c1-13-4-6-14(7-5-13)11-18-12-15-8-9-16(19-2)10-17(15)20-3;3-1(4)2(5)6/h4-10,18H,11-12H2,1-3H3;(H,3,4)(H,5,6).
What are the key properties of N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid?
N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid has a molecular weight of 361.39 g/mol, XLogP of 2.46, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dimethoxyphenyl)methyl]-1-(4-methylphenyl)methanamine;oxalic acid is sourced from PubChem (CID 23724255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).