C16H24BrClN2O — CID 23724258
N-(4-bromo-3-methylphenyl)-3-(4-methylpiperidin-1-yl)propanamide;hydrochloride (PubChem CID 23724258) has the molecular formula C16H24BrClN2O and a molecular weight of 375.74 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-3-(4-methylpiperidin-1-yl)propanamide;hydrochloride.
| Compound Name | N-(4-bromo-3-methylphenyl)-3-(4-methylpiperidin-1-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 23724258 |
| Molecular Formula | C16H24BrClN2O |
| Molecular Weight | 375.74 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-3-(4-methylpiperidin-1-yl)propanamide;hydrochloride |
| SMILES | Cc1cc(NC(=O)CCN2CCC(C)CC2)ccc1Br.Cl |
| InChI | InChI=1S/C16H23BrN2O.ClH/c1-12-5-8-19(9-6-12)10-7-16(20)18-14-3-4-15(17)13(2)11-14;/h3-4,11-12H,5-10H2,1-2H3,(H,18,20);1H |
| InChIKey | GHPSZWFRAVFUDY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.74 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |