About ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate
ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate (PubChem CID 23724281) has the molecular formula C21H20N4O3
and a molecular weight of 376.42 g/mol. Its IUPAC name is ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate |
| PubChem CID | 23724281 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)nn1CC1CC(c2cccnc2)=NO1 |
| InChI | InChI=1S/C21H20N4O3/c1-2-27-21(26)20-12-18(15-7-4-3-5-8-15)23-25(20)14-17-11-19(24-28-17)16-9-6-10-22-13-16/h3-10,12-13,17H,2,11,14H2,1H3 |
| InChIKey | MCLFFVLZWYCOAG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate?
The IUPAC name of ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate (CID 23724281) is ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate.
What is the SMILES notation for ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate?
The canonical SMILES for ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate is CCOC(=O)c1cc(-c2ccccc2)nn1CC1CC(c2cccnc2)=NO1.
What is the InChIKey of ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate?
The InChIKey is MCLFFVLZWYCOAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O3/c1-2-27-21(26)20-12-18(15-7-4-3-5-8-15)23-25(20)14-17-11-19(24-28-17)16-9-6-10-22-13-16/h3-10,12-13,17H,2,11,14H2,1H3.
What are the key properties of ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate?
ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate has a molecular weight of 376.42 g/mol, XLogP of 3.32, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-phenyl-1-[(3-pyridin-3-yl-4,5-dihydro-1,2-oxazol-5-yl)methyl]pyrazole-5-carboxylate is sourced from PubChem (CID 23724281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).