About ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid
ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid (PubChem CID 23724288) has the molecular formula C24H29NO7
and a molecular weight of 443.50 g/mol. Its IUPAC name is ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid.
Molecular Properties
| Compound Name | ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid |
| PubChem CID | 23724288 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid |
| SMILES | CCOC(=O)C1CCCN(Cc2ccc(OCc3ccccc3)cc2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H27NO3.C2H2O4/c1-2-25-22(24)20-9-6-14-23(16-20)15-18-10-12-21(13-11-18)26-17-19-7-4-3-5-8-19;3-1(4)2(5)6/h3-5,7-8,10-13,20H,2,6,9,14-17H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | LQNJQQXGDSQIOK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid?
The IUPAC name of ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid (CID 23724288) is ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid.
What is the SMILES notation for ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid?
The canonical SMILES for ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid is CCOC(=O)C1CCCN(Cc2ccc(OCc3ccccc3)cc2)C1.O=C(O)C(=O)O.
What is the InChIKey of ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid?
The InChIKey is LQNJQQXGDSQIOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27NO3.C2H2O4/c1-2-25-22(24)20-9-6-14-23(16-20)15-18-10-12-21(13-11-18)26-17-19-7-4-3-5-8-19;3-1(4)2(5)6/h3-5,7-8,10-13,20H,2,6,9,14-17H2,1H3;(H,3,4)(H,5,6).
What are the key properties of ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid?
ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid has a molecular weight of 443.50 g/mol, XLogP of 3.20, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(4-phenylmethoxyphenyl)methyl]piperidine-3-carboxylate;oxalic acid is sourced from PubChem (CID 23724288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).