About N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride
N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride (PubChem CID 23724319) has the molecular formula C15H17ClN2O
and a molecular weight of 276.77 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride.
Molecular Properties
| Compound Name | N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride |
| PubChem CID | 23724319 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride |
| SMILES | Cc1ccc(C)c(NC(=O)C[n+]2ccccc2)c1.[Cl-] |
| InChI | InChI=1S/C15H16N2O.ClH/c1-12-6-7-13(2)14(10-12)16-15(18)11-17-8-4-3-5-9-17;/h3-10H,11H2,1-2H3;1H |
| InChIKey | JPIYEFUWJOTHAY-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride?
The IUPAC name of N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride (CID 23724319) is N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride.
What is the SMILES notation for N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride?
The canonical SMILES for N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride is Cc1ccc(C)c(NC(=O)C[n+]2ccccc2)c1.[Cl-].
What is the InChIKey of N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride?
The InChIKey is JPIYEFUWJOTHAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O.ClH/c1-12-6-7-13(2)14(10-12)16-15(18)11-17-8-4-3-5-9-17;/h3-10H,11H2,1-2H3;1H.
What are the key properties of N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride?
N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride has a molecular weight of 276.77 g/mol, XLogP of -0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethylphenyl)-2-pyridin-1-ium-1-ylacetamide chloride is sourced from PubChem (CID 23724319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).