About N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid
N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid (PubChem CID 23724323) has the molecular formula C11H18ClN3O5S
and a molecular weight of 339.80 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid.
Molecular Properties
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid |
| PubChem CID | 23724323 |
| Molecular Formula | C11H18ClN3O5S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid |
| SMILES | Cc1cnc(NC(=O)CN2CCCCC2)s1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C11H17N3OS.ClHO4/c1-9-7-12-11(16-9)13-10(15)8-14-5-3-2-4-6-14;2-1(3,4)5/h7H,2-6,8H2,1H3,(H,12,13,15);(H,2,3,4,5) |
| InChIKey | BDAYWIPYIFAABR-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid?
The IUPAC name of N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid (CID 23724323) is N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid.
What is the SMILES notation for N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid?
The canonical SMILES for N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid is Cc1cnc(NC(=O)CN2CCCCC2)s1.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid?
The InChIKey is BDAYWIPYIFAABR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3OS.ClHO4/c1-9-7-12-11(16-9)13-10(15)8-14-5-3-2-4-6-14;2-1(3,4)5/h7H,2-6,8H2,1H3,(H,12,13,15);(H,2,3,4,5).
What are the key properties of N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid?
N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid has a molecular weight of 339.80 g/mol, XLogP of -2.25, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-1,3-thiazol-2-yl)-2-piperidin-1-ylacetamide;perchloric acid is sourced from PubChem (CID 23724323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).