C12H14ClNO — CID 23724372
6,7,8,9-tetrahydrodibenzofuran-4-amine;hydrochloride (PubChem CID 23724372) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is 6,7,8,9-tetrahydrodibenzofuran-4-amine;hydrochloride.
| Compound Name | 6,7,8,9-tetrahydrodibenzofuran-4-amine;hydrochloride |
|---|---|
| PubChem CID | 23724372 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 6,7,8,9-tetrahydrodibenzofuran-4-amine;hydrochloride |
| SMILES | Cl.Nc1cccc2c3c(oc12)CCCC3 |
| InChI | InChI=1S/C12H13NO.ClH/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10;/h3,5-6H,1-2,4,7,13H2;1H |
| InChIKey | KZFHXJPWUVWYJU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|