C21H22N6O2 — CID 23724425
3-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 23724425) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 3-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 23724425 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-benzyl-N-[2-(3,4-dimethoxyphenyl)ethyl]triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | COc1ccc(CCNc2ncnc3c2nnn3Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C21H22N6O2/c1-28-17-9-8-15(12-18(17)29-2)10-11-22-20-19-21(24-14-23-20)27(26-25-19)13-16-6-4-3-5-7-16/h3-9,12,14H,10-11,13H2,1-2H3,(H,22,23,24) |
| InChIKey | QHAPTTOJHBYJJH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |