About 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride
2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride (PubChem CID 23724801) has the molecular formula C21H26ClNO3
and a molecular weight of 375.90 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride |
| PubChem CID | 23724801 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride |
| SMILES | Cl.O=C(OCCN1CCCCC1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3.ClH/c23-20(25-17-16-22-14-8-3-9-15-22)21(24,18-10-4-1-5-11-18)19-12-6-2-7-13-19;/h1-2,4-7,10-13,24H,3,8-9,14-17H2;1H |
| InChIKey | ZJVKLBBPLUXEAC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride?
The IUPAC name of 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride (CID 23724801) is 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride.
What is the SMILES notation for 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride?
The canonical SMILES for 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride is Cl.O=C(OCCN1CCCCC1)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride?
The InChIKey is ZJVKLBBPLUXEAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO3.ClH/c23-20(25-17-16-22-14-8-3-9-15-22)21(24,18-10-4-1-5-11-18)19-12-6-2-7-13-19;/h1-2,4-7,10-13,24H,3,8-9,14-17H2;1H.
What are the key properties of 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride?
2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride has a molecular weight of 375.90 g/mol, XLogP of 3.37, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride is sourced from PubChem (CID 23724801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).