About 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride
3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride (PubChem CID 23724817) has the molecular formula C19H34Cl2N2O2
and a molecular weight of 393.40 g/mol. Its IUPAC name is 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride.
Molecular Properties
| Compound Name | 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride |
| PubChem CID | 23724817 |
| Molecular Formula | C19H34Cl2N2O2 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride |
| SMILES | CCN(CC)CCNC(C(=O)OCCC(C)C)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C19H32N2O2.2ClH/c1-5-21(6-2)14-13-20-18(17-10-8-7-9-11-17)19(22)23-15-12-16(3)4;;/h7-11,16,18,20H,5-6,12-15H2,1-4H3;2*1H |
| InChIKey | ZHRVNCCPAKIGRH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride?
The IUPAC name of 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride (CID 23724817) is 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride.
What is the SMILES notation for 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride?
The canonical SMILES for 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride is CCN(CC)CCNC(C(=O)OCCC(C)C)c1ccccc1.Cl.Cl.
What is the InChIKey of 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride?
The InChIKey is ZHRVNCCPAKIGRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O2.2ClH/c1-5-21(6-2)14-13-20-18(17-10-8-7-9-11-17)19(22)23-15-12-16(3)4;;/h7-11,16,18,20H,5-6,12-15H2,1-4H3;2*1H.
What are the key properties of 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride?
3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride has a molecular weight of 393.40 g/mol, XLogP of 4.09, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 2-[2-(diethylamino)ethylamino]-2-phenylacetate;dihydrochloride is sourced from PubChem (CID 23724817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).