C19H18N2O4S — CID 23725195
(1-naphthalen-2-ylsulfonylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone (PubChem CID 23725195) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is (1-naphthalen-2-ylsulfonylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone.
| Compound Name | (1-naphthalen-2-ylsulfonylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone |
|---|---|
| PubChem CID | 23725195 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (1-naphthalen-2-ylsulfonylpiperidin-4-yl)-(1,3-oxazol-2-yl)methanone |
| SMILES | O=C(c1ncco1)C1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C19H18N2O4S/c22-18(19-20-9-12-25-19)15-7-10-21(11-8-15)26(23,24)17-6-5-14-3-1-2-4-16(14)13-17/h1-6,9,12-13,15H,7-8,10-11H2 |
| InChIKey | DELAGPRSKHSUBJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |