About 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole
4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole (PubChem CID 23725269) has the molecular formula C19H13Cl2N3O
and a molecular weight of 370.24 g/mol. Its IUPAC name is 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole.
Molecular Properties
| Compound Name | 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole |
| PubChem CID | 23725269 |
| Molecular Formula | C19H13Cl2N3O |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole |
| SMILES | Cc1onc(-c2ccccc2)c1-c1cn(-c2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C19H13Cl2N3O/c1-12-18(19(23-25-12)13-5-3-2-4-6-13)17-10-24(11-22-17)14-7-8-15(20)16(21)9-14/h2-11H,1H3 |
| InChIKey | RIEZQVRIBQVMCB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole?
The IUPAC name of 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole (CID 23725269) is 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole.
What is the SMILES notation for 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole?
The canonical SMILES for 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole is Cc1onc(-c2ccccc2)c1-c1cn(-c2ccc(Cl)c(Cl)c2)cn1.
What is the InChIKey of 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole?
The InChIKey is RIEZQVRIBQVMCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl2N3O/c1-12-18(19(23-25-12)13-5-3-2-4-6-13)17-10-24(11-22-17)14-7-8-15(20)16(21)9-14/h2-11H,1H3.
What are the key properties of 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole?
4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole has a molecular weight of 370.24 g/mol, XLogP of 5.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,4-dichlorophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole is sourced from PubChem (CID 23725269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).