C21H24N6O3 — CID 23725348
N'-[3-[(1S,3S)-5-hydroxy-2-adamantyl]-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-5-yl]-N-methyloxamide (PubChem CID 23725348) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is N'-[3-[(1S,3S)-5-hydroxy-2-adamantyl]-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-5-yl]-N-methyloxamide.
| Compound Name | N'-[3-[(1S,3S)-5-hydroxy-2-adamantyl]-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-5-yl]-N-methyloxamide |
|---|---|
| PubChem CID | 23725348 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N'-[3-[(1S,3S)-5-hydroxy-2-adamantyl]-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,5,7,9,11-pentaen-5-yl]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)Nc1[nH]n(C2[C@H]3CC4C[C@H]2CC(O)(C4)C3)c2c1cnc1nccc12 |
| InChI | InChI=1S/C21H24N6O3/c1-22-19(28)20(29)25-18-14-9-24-17-13(2-3-23-17)16(14)27(26-18)15-11-4-10-5-12(15)8-21(30,6-10)7-11/h2-3,9-12,15,26,30H,4-8H2,1H3,(H,22,28)(H,25,29)/t10?,11-,12-,15?,21?/m0/s1 |
| InChIKey | NDCQRQLRGSJAGL-JURSOMLRSA-N |
| XLogP | 1.71 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|