C29H28FN7O2 — CID 23725350
6-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-N-[4-(1,2,4-triazol-1-yl)phenyl]quinazolin-4-amine (PubChem CID 23725350) has the molecular formula C29H28FN7O2 and a molecular weight of 525.59 g/mol. Its IUPAC name is 6-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-N-[4-(1,2,4-triazol-1-yl)phenyl]quinazolin-4-amine.
| Compound Name | 6-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-N-[4-(1,2,4-triazol-1-yl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 23725350 |
| Molecular Formula | C29H28FN7O2 |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 6-[3-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-N-[4-(1,2,4-triazol-1-yl)phenyl]quinazolin-4-amine |
| SMILES | Fc1cc(-c2ccc3ncnc(Nc4ccc(-n5cncn5)cc4)c3c2)ccc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C29H28FN7O2/c30-26-17-22(3-9-28(26)39-13-1-10-36-11-14-38-15-12-36)21-2-8-27-25(16-21)29(33-19-32-27)35-23-4-6-24(7-5-23)37-20-31-18-34-37/h2-9,16-20H,1,10-15H2,(H,32,33,35) |
| InChIKey | GKYLJRJEKBEWHE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|