About 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate
2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 23725422) has the molecular formula C14H15FN2O2
and a molecular weight of 262.28 g/mol. Its IUPAC name is 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| PubChem CID | 23725422 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | C[C@H](c1ccccc1)n1cncc1C(=O)OCCF |
| InChI | InChI=1S/C14H15FN2O2/c1-11(12-5-3-2-4-6-12)17-10-16-9-13(17)14(18)19-8-7-15/h2-6,9-11H,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | JYDPBIIFPAOXMK-LLVKDONJSA-N |
| XLogP | 2.62 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
The IUPAC name of 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (CID 23725422) is 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
What is the SMILES notation for 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
The canonical SMILES for 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate is C[C@H](c1ccccc1)n1cncc1C(=O)OCCF.
What is the InChIKey of 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
The InChIKey is JYDPBIIFPAOXMK-LLVKDONJSA-N. The full InChI is InChI=1S/C14H15FN2O2/c1-11(12-5-3-2-4-6-12)17-10-16-9-13(17)14(18)19-8-7-15/h2-6,9-11H,7-8H2,1H3/t11-/m1/s1.
What are the key properties of 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate has a molecular weight of 262.28 g/mol, XLogP of 2.62, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate is sourced from PubChem (CID 23725422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).