About 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one
5-(hydroxymethyl)-3,4-dihydroisochromen-1-one (PubChem CID 23725722) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one |
| PubChem CID | 23725722 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one |
| SMILES | O=C1OCCc2c(CO)cccc21 |
| InChI | InChI=1S/C10H10O3/c11-6-7-2-1-3-9-8(7)4-5-13-10(9)12/h1-3,11H,4-6H2 |
| InChIKey | DNNSYXUCMMUSNY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one?
The IUPAC name of 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one (CID 23725722) is 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one.
What is the SMILES notation for 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one?
The canonical SMILES for 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one is O=C1OCCc2c(CO)cccc21.
What is the InChIKey of 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one?
The InChIKey is DNNSYXUCMMUSNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c11-6-7-2-1-3-9-8(7)4-5-13-10(9)12/h1-3,11H,4-6H2.
What are the key properties of 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one?
5-(hydroxymethyl)-3,4-dihydroisochromen-1-one has a molecular weight of 178.19 g/mol, XLogP of 0.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-3,4-dihydroisochromen-1-one is sourced from PubChem (CID 23725722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).