C16H10ClN3O2 — CID 23726078
16-chloro-9,17,19-triazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione (PubChem CID 23726078) has the molecular formula C16H10ClN3O2 and a molecular weight of 311.73 g/mol. Its IUPAC name is 16-chloro-9,17,19-triazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione.
| Compound Name | 16-chloro-9,17,19-triazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione |
|---|---|
| PubChem CID | 23726078 |
| Molecular Formula | C16H10ClN3O2 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 16-chloro-9,17,19-triazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),2(6),7(11),13(18),14,16-hexaene-8,10-dione |
| SMILES | O=C1NC(=O)c2c1c1c(c3[nH]c4nc(Cl)ccc4c23)CCC1 |
| InChI | InChI=1S/C16H10ClN3O2/c17-9-5-4-8-10-12-11(15(21)20-16(12)22)6-2-1-3-7(6)13(10)19-14(8)18-9/h4-5H,1-3H2,(H,18,19)(H,20,21,22) |
| InChIKey | INUJEAITJYQLTF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|