C8H4CsF5O2S2 — CID 23726133
cesium 1,1,2,2-tetrafluoro-2-(4-fluorophenyl)sulfanylethanesulfinate (PubChem CID 23726133) has the molecular formula C8H4CsF5O2S2 and a molecular weight of 424.15 g/mol. Its IUPAC name is cesium 1,1,2,2-tetrafluoro-2-(4-fluorophenyl)sulfanylethanesulfinate.
| Compound Name | cesium 1,1,2,2-tetrafluoro-2-(4-fluorophenyl)sulfanylethanesulfinate |
|---|---|
| PubChem CID | 23726133 |
| Molecular Formula | C8H4CsF5O2S2 |
| Molecular Weight | 424.15 g/mol |
| Exact Mass | 423.86 |
| IUPAC Name | cesium 1,1,2,2-tetrafluoro-2-(4-fluorophenyl)sulfanylethanesulfinate |
| SMILES | O=S([O-])C(F)(F)C(F)(F)Sc1ccc(F)cc1.[Cs+] |
| InChI | InChI=1S/C8H5F5O2S2.Cs/c9-5-1-3-6(4-2-5)16-7(10,11)8(12,13)17(14)15;/h1-4H,(H,14,15);/q;+1/p-1 |
| InChIKey | WVBSLQPUUQAQNI-UHFFFAOYSA-M |
| XLogP | -0.01 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.15 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|