C8H4BrCsF4O2S2 — CID 23726195
cesium 2-(4-bromophenyl)sulfanyl-1,1,2,2-tetrafluoroethanesulfinate (PubChem CID 23726195) has the molecular formula C8H4BrCsF4O2S2 and a molecular weight of 485.05 g/mol. Its IUPAC name is cesium 2-(4-bromophenyl)sulfanyl-1,1,2,2-tetrafluoroethanesulfinate.
| Compound Name | cesium 2-(4-bromophenyl)sulfanyl-1,1,2,2-tetrafluoroethanesulfinate |
|---|---|
| PubChem CID | 23726195 |
| Molecular Formula | C8H4BrCsF4O2S2 |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 483.78 |
| IUPAC Name | cesium 2-(4-bromophenyl)sulfanyl-1,1,2,2-tetrafluoroethanesulfinate |
| SMILES | O=S([O-])C(F)(F)C(F)(F)Sc1ccc(Br)cc1.[Cs+] |
| InChI | InChI=1S/C8H5BrF4O2S2.Cs/c9-5-1-3-6(4-2-5)16-7(10,11)8(12,13)17(14)15;/h1-4H,(H,14,15);/q;+1/p-1 |
| InChIKey | JNOTYIQPEZWYHC-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|