C21H40O2Si — CID 23726370
(3R,4S,7E,9S)-2,4,8-trimethyl-6-methylidene-9-triethylsilyloxyundeca-1,7-dien-3-ol (PubChem CID 23726370) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is (3R,4S,7E,9S)-2,4,8-trimethyl-6-methylidene-9-triethylsilyloxyundeca-1,7-dien-3-ol.
| Compound Name | (3R,4S,7E,9S)-2,4,8-trimethyl-6-methylidene-9-triethylsilyloxyundeca-1,7-dien-3-ol |
|---|---|
| PubChem CID | 23726370 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | (3R,4S,7E,9S)-2,4,8-trimethyl-6-methylidene-9-triethylsilyloxyundeca-1,7-dien-3-ol |
| SMILES | C=C(/C=C(\C)[C@H](CC)O[Si](CC)(CC)CC)C[C@H](C)[C@@H](O)C(=C)C |
| InChI | InChI=1S/C21H40O2Si/c1-10-20(23-24(11-2,12-3)13-4)18(8)14-17(7)15-19(9)21(22)16(5)6/h14,19-22H,5,7,10-13,15H2,1-4,6,8-9H3/b18-14+/t19-,20-,21-/m0/s1 |
| InChIKey | QOXVEYODFHSAEY-PNVRCKIDSA-N |
| XLogP | 6.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|