C22H25FN4O2S — CID 23726503
1-[(6aR,10aS)-2-ethylsulfanyl-6-oxo-5,6a,7,8,9,10,10a,11-octahydrobenzo[b][1,4]benzodiazepin-3-yl]-3-(4-fluorophenyl)urea (PubChem CID 23726503) has the molecular formula C22H25FN4O2S and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-[(6aR,10aS)-2-ethylsulfanyl-6-oxo-5,6a,7,8,9,10,10a,11-octahydrobenzo[b][1,4]benzodiazepin-3-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(6aR,10aS)-2-ethylsulfanyl-6-oxo-5,6a,7,8,9,10,10a,11-octahydrobenzo[b][1,4]benzodiazepin-3-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 23726503 |
| Molecular Formula | C22H25FN4O2S |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 1-[(6aR,10aS)-2-ethylsulfanyl-6-oxo-5,6a,7,8,9,10,10a,11-octahydrobenzo[b][1,4]benzodiazepin-3-yl]-3-(4-fluorophenyl)urea |
| SMILES | CCSc1cc2c(cc1NC(=O)Nc1ccc(F)cc1)NC(=O)[C@@H]1CCCC[C@@H]1N2 |
| InChI | InChI=1S/C22H25FN4O2S/c1-2-30-20-12-18-17(26-21(28)15-5-3-4-6-16(15)25-18)11-19(20)27-22(29)24-14-9-7-13(23)8-10-14/h7-12,15-16,25H,2-6H2,1H3,(H,26,28)(H2,24,27,29)/t15-,16+/m1/s1 |
| InChIKey | QZUBIBQBUJNGEB-CVEARBPZSA-N |
| XLogP | 5.50 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |