About 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium
3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium (PubChem CID 23726653) has the molecular formula C10H11NO4S2
and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium.
Molecular Properties
| Compound Name | 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium |
| PubChem CID | 23726653 |
| Molecular Formula | C10H11NO4S2 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium |
| SMILES | CS(=O)(=O)C1=[N+]([O-])OC(/C=C/c2cccs2)C1 |
| InChI | InChI=1S/C10H11NO4S2/c1-17(13,14)10-7-8(15-11(10)12)4-5-9-3-2-6-16-9/h2-6,8H,7H2,1H3/b5-4+ |
| InChIKey | CQQUAJKEISZETF-SNAWJCMRSA-N |
| XLogP | 1.42 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium?
The IUPAC name of 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium (CID 23726653) is 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium.
What is the SMILES notation for 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium?
The canonical SMILES for 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium is CS(=O)(=O)C1=[N+]([O-])OC(/C=C/c2cccs2)C1.
What is the InChIKey of 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium?
The InChIKey is CQQUAJKEISZETF-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H11NO4S2/c1-17(13,14)10-7-8(15-11(10)12)4-5-9-3-2-6-16-9/h2-6,8H,7H2,1H3/b5-4+.
What are the key properties of 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium?
3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium has a molecular weight of 273.33 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfonyl-2-oxido-5-[(E)-2-thiophen-2-ylethenyl]-4,5-dihydro-1,2-oxazol-2-ium is sourced from PubChem (CID 23726653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).