About 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium
3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium (PubChem CID 23727216) has the molecular formula C16H15NO4S
and a molecular weight of 317.37 g/mol. Its IUPAC name is 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium.
Molecular Properties
| Compound Name | 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium |
| PubChem CID | 23727216 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium |
| SMILES | CS(=O)(=O)C1=[N+]([O-])OC(/C=C/c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C16H15NO4S/c1-22(19,20)16-11-14(21-17(16)18)10-9-13-7-4-6-12-5-2-3-8-15(12)13/h2-10,14H,11H2,1H3/b10-9+ |
| InChIKey | CYRDYIVKYQFYNR-MDZDMXLPSA-N |
| XLogP | 2.51 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium?
The IUPAC name of 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium (CID 23727216) is 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium.
What is the SMILES notation for 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium?
The canonical SMILES for 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium is CS(=O)(=O)C1=[N+]([O-])OC(/C=C/c2cccc3ccccc23)C1.
What is the InChIKey of 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium?
The InChIKey is CYRDYIVKYQFYNR-MDZDMXLPSA-N. The full InChI is InChI=1S/C16H15NO4S/c1-22(19,20)16-11-14(21-17(16)18)10-9-13-7-4-6-12-5-2-3-8-15(12)13/h2-10,14H,11H2,1H3/b10-9+.
What are the key properties of 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium?
3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium has a molecular weight of 317.37 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfonyl-5-[(E)-2-naphthalen-1-ylethenyl]-2-oxido-4,5-dihydro-1,2-oxazol-2-ium is sourced from PubChem (CID 23727216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).