C40H54N4O4 — CID 23727304
(4S)-2-[2-[2,6-bis[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-3-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4-tert-butyl-4,5-dihydro-1,3-oxazole (PubChem CID 23727304) has the molecular formula C40H54N4O4 and a molecular weight of 654.90 g/mol. Its IUPAC name is (4S)-2-[2-[2,6-bis[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-3-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4-tert-butyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[2-[2,6-bis[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-3-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4-tert-butyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 23727304 |
| Molecular Formula | C40H54N4O4 |
| Molecular Weight | 654.90 g/mol |
| Exact Mass | 654.41 |
| IUPAC Name | (4S)-2-[2-[2,6-bis[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-3-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-4-tert-butyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(C)[C@H]1COC(c2cccc(C3=N[C@@H](C(C)(C)C)CO3)c2-c2c(C3=N[C@@H](C(C)(C)C)CO3)cccc2C2=N[C@@H](C(C)(C)C)CO2)=N1 |
| InChI | InChI=1S/C40H54N4O4/c1-37(2,3)27-19-45-33(41-27)23-15-13-16-24(34-42-28(20-46-34)38(4,5)6)31(23)32-25(35-43-29(21-47-35)39(7,8)9)17-14-18-26(32)36-44-30(22-48-36)40(10,11)12/h13-18,27-30H,19-22H2,1-12H3/t27-,28-,29-,30-/m1/s1 |
| InChIKey | KBJQYOAXLDQRQV-SKKKGAJSSA-N |
| XLogP | 8.12 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.90 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |