C35H53NO5Si2 — CID 23727350
tert-butyl (3E,5S)-3-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxopyrrolidine-1-carboxylate (PubChem CID 23727350) has the molecular formula C35H53NO5Si2 and a molecular weight of 623.98 g/mol. Its IUPAC name is tert-butyl (3E,5S)-3-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3E,5S)-3-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23727350 |
| Molecular Formula | C35H53NO5Si2 |
| Molecular Weight | 623.98 g/mol |
| Exact Mass | 623.35 |
| IUPAC Name | tert-butyl (3E,5S)-3-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)/C(=C/CCO[Si](C)(C)C(C)(C)C)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H53NO5Si2/c1-33(2,3)41-32(38)36-28(25-27(31(36)37)19-18-24-39-42(10,11)34(4,5)6)26-40-43(35(7,8)9,29-20-14-12-15-21-29)30-22-16-13-17-23-30/h12-17,19-23,28H,18,24-26H2,1-11H3/b27-19+/t28-/m0/s1 |
| InChIKey | YXIWJAHPAPNDPE-CSVFCKANSA-N |
| XLogP | 7.44 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.98 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|