About 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran
2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran (PubChem CID 23727580) has the molecular formula C16H14O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran.
Molecular Properties
| Compound Name | 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran |
| PubChem CID | 23727580 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran |
| SMILES | C=CCc1cc2cc3cc(CC=C)oc3cc2o1 |
| InChI | InChI=1S/C16H14O2/c1-3-5-13-8-11-7-12-9-14(6-4-2)18-16(12)10-15(11)17-13/h3-4,7-10H,1-2,5-6H2 |
| InChIKey | ADXXKDUKIDYMFG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran?
The IUPAC name of 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran (CID 23727580) is 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran.
What is the SMILES notation for 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran?
The canonical SMILES for 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran is C=CCc1cc2cc3cc(CC=C)oc3cc2o1.
What is the InChIKey of 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran?
The InChIKey is ADXXKDUKIDYMFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O2/c1-3-5-13-8-11-7-12-9-14(6-4-2)18-16(12)10-15(11)17-13/h3-4,7-10H,1-2,5-6H2.
What are the key properties of 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran?
2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran has a molecular weight of 238.29 g/mol, XLogP of 4.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(prop-2-enyl)furo[3,2-f][1]benzofuran is sourced from PubChem (CID 23727580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).