C15H27N3O7P2 — CID 23727679
[(2E,6E)-8-azido-3,7,11-trimethyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate (PubChem CID 23727679) has the molecular formula C15H27N3O7P2 and a molecular weight of 423.34 g/mol. Its IUPAC name is [(2E,6E)-8-azido-3,7,11-trimethyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate.
| Compound Name | [(2E,6E)-8-azido-3,7,11-trimethyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 23727679 |
| Molecular Formula | C15H27N3O7P2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [(2E,6E)-8-azido-3,7,11-trimethyldodeca-2,6,10-trienyl] phosphono hydrogen phosphate |
| SMILES | CC(C)=CCC(N=[N+]=[N-])/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C15H27N3O7P2/c1-12(2)8-9-15(17-18-16)14(4)7-5-6-13(3)10-11-24-27(22,23)25-26(19,20)21/h7-8,10,15H,5-6,9,11H2,1-4H3,(H,22,23)(H2,19,20,21)/b13-10+,14-7+ |
| InChIKey | XRWSGNSZXQPGGZ-KIYZNAMYSA-N |
| XLogP | 4.92 |
| TPSA | 162.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|