About [(E)-but-2-enyl] imidazole-1-carboxylate
[(E)-but-2-enyl] imidazole-1-carboxylate (PubChem CID 23727755) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is [(E)-but-2-enyl] imidazole-1-carboxylate.
Molecular Properties
| Compound Name | [(E)-but-2-enyl] imidazole-1-carboxylate |
| PubChem CID | 23727755 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | [(E)-but-2-enyl] imidazole-1-carboxylate |
| SMILES | C/C=C/COC(=O)n1ccnc1 |
| InChI | InChI=1S/C8H10N2O2/c1-2-3-6-12-8(11)10-5-4-9-7-10/h2-5,7H,6H2,1H3/b3-2+ |
| InChIKey | JGNHUWISNXLDCV-NSCUHMNNSA-N |
| XLogP | 1.44 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-enyl] imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-enyl] imidazole-1-carboxylate?
The IUPAC name of [(E)-but-2-enyl] imidazole-1-carboxylate (CID 23727755) is [(E)-but-2-enyl] imidazole-1-carboxylate.
What is the SMILES notation for [(E)-but-2-enyl] imidazole-1-carboxylate?
The canonical SMILES for [(E)-but-2-enyl] imidazole-1-carboxylate is C/C=C/COC(=O)n1ccnc1.
What is the InChIKey of [(E)-but-2-enyl] imidazole-1-carboxylate?
The InChIKey is JGNHUWISNXLDCV-NSCUHMNNSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-2-3-6-12-8(11)10-5-4-9-7-10/h2-5,7H,6H2,1H3/b3-2+.
What are the key properties of [(E)-but-2-enyl] imidazole-1-carboxylate?
[(E)-but-2-enyl] imidazole-1-carboxylate has a molecular weight of 166.18 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-enyl] imidazole-1-carboxylate is sourced from PubChem (CID 23727755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).