C40H54F6O8 — CID 23727906
[(7S,11R)-11-hydroxy-3,7,11,15-tetramethyl-4-oxo-16-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxyhexadecyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 23727906) has the molecular formula C40H54F6O8 and a molecular weight of 776.85 g/mol. Its IUPAC name is [(7S,11R)-11-hydroxy-3,7,11,15-tetramethyl-4-oxo-16-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxyhexadecyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(7S,11R)-11-hydroxy-3,7,11,15-tetramethyl-4-oxo-16-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxyhexadecyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 23727906 |
| Molecular Formula | C40H54F6O8 |
| Molecular Weight | 776.85 g/mol |
| Exact Mass | 776.37 |
| IUPAC Name | [(7S,11R)-11-hydroxy-3,7,11,15-tetramethyl-4-oxo-16-(3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl)oxyhexadecyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COC(C(=O)OCCC(C)C(=O)CC[C@@H](C)CCC[C@@](C)(O)CCCC(C)COC(=O)C(OC)(c1ccccc1)C(F)(F)F)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C40H54F6O8/c1-28(21-22-33(47)30(3)23-26-53-34(48)37(51-5,39(41,42)43)31-17-9-7-10-18-31)15-13-24-36(4,50)25-14-16-29(2)27-54-35(49)38(52-6,40(44,45)46)32-19-11-8-12-20-32/h7-12,17-20,28-30,50H,13-16,21-27H2,1-6H3/t28-,29?,30?,36+,37?,38?/m0/s1 |
| InChIKey | VFIOOVQCTRKTAK-WVKPWWMHSA-N |
| XLogP | 9.02 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.85 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |