C30H52O4Si — CID 23727932
ethyl (E,6R,10R)-12-[tert-butyl(dimethyl)silyl]oxy-2,6,10-trimethyl-9-phenylmethoxydodec-2-enoate (PubChem CID 23727932) has the molecular formula C30H52O4Si and a molecular weight of 504.83 g/mol. Its IUPAC name is ethyl (E,6R,10R)-12-[tert-butyl(dimethyl)silyl]oxy-2,6,10-trimethyl-9-phenylmethoxydodec-2-enoate.
| Compound Name | ethyl (E,6R,10R)-12-[tert-butyl(dimethyl)silyl]oxy-2,6,10-trimethyl-9-phenylmethoxydodec-2-enoate |
|---|---|
| PubChem CID | 23727932 |
| Molecular Formula | C30H52O4Si |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | ethyl (E,6R,10R)-12-[tert-butyl(dimethyl)silyl]oxy-2,6,10-trimethyl-9-phenylmethoxydodec-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CC[C@@H](C)CCC(OCc1ccccc1)[C@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H52O4Si/c1-10-32-29(31)26(4)16-14-15-24(2)19-20-28(33-23-27-17-12-11-13-18-27)25(3)21-22-34-35(8,9)30(5,6)7/h11-13,16-18,24-25,28H,10,14-15,19-23H2,1-9H3/b26-16+/t24-,25-,28?/m1/s1 |
| InChIKey | SQZFTVCYWZRHNI-MDIDCCRNSA-N |
| XLogP | 8.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|