C30H50N2O5S — CID 23728342
ethyl (5S,6S,7R)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-9-methyl-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23728342) has the molecular formula C30H50N2O5S and a molecular weight of 550.81 g/mol. Its IUPAC name is ethyl (5S,6S,7R)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-9-methyl-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6S,7R)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-9-methyl-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23728342 |
| Molecular Formula | C30H50N2O5S |
| Molecular Weight | 550.81 g/mol |
| Exact Mass | 550.34 |
| IUPAC Name | ethyl (5S,6S,7R)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-9-methyl-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N([C@@H](CO)CC(C)C)C(=O)[C@@H]2[C@@H](C(=O)OCC)[C@H]3CC(C)C12S3)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C30H50N2O5S/c1-11-13-31(29(9,10)17-28(6,7)8)26(35)24-30-19(5)15-21(38-30)22(27(36)37-12-2)23(30)25(34)32(24)20(16-33)14-18(3)4/h11,18-24,33H,1,12-17H2,2-10H3/t19?,20-,21-,22+,23+,24?,30?/m1/s1 |
| InChIKey | ZYGMSRULKVUYHC-FABZFTTASA-N |
| XLogP | 4.52 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|