C24H36N2O5S — CID 23728353
but-3-enyl (5S,6R,7S)-3-(2-hydroxyethyl)-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23728353) has the molecular formula C24H36N2O5S and a molecular weight of 464.63 g/mol. Its IUPAC name is but-3-enyl (5S,6R,7S)-3-(2-hydroxyethyl)-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | but-3-enyl (5S,6R,7S)-3-(2-hydroxyethyl)-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23728353 |
| Molecular Formula | C24H36N2O5S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | but-3-enyl (5S,6R,7S)-3-(2-hydroxyethyl)-4-oxo-2-[pentan-2-yl(prop-2-enyl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCCOC(=O)[C@@H]1[C@@H]2CCC3(S2)C(C(=O)N(CC=C)C(C)CCC)N(CCO)C(=O)[C@H]13 |
| InChI | InChI=1S/C24H36N2O5S/c1-5-8-15-31-23(30)18-17-10-11-24(32-17)19(18)21(28)26(13-14-27)20(24)22(29)25(12-7-3)16(4)9-6-2/h5,7,16-20,27H,1,3,6,8-15H2,2,4H3/t16?,17-,18+,19-,20?,24?/m0/s1 |
| InChIKey | XWVPXQATOIDSMF-REXZRALJSA-N |
| XLogP | 2.39 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|