C22H34N2O3 — CID 23728684
methyl (5R)-5-[(1S,6Z,10Z,14R)-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-3-yl]-3,4-dihydropyrazole-5-carboxylate (PubChem CID 23728684) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is methyl (5R)-5-[(1S,6Z,10Z,14R)-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-3-yl]-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | methyl (5R)-5-[(1S,6Z,10Z,14R)-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-3-yl]-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 23728684 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | methyl (5R)-5-[(1S,6Z,10Z,14R)-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadeca-6,10-dien-3-yl]-3,4-dihydropyrazole-5-carboxylate |
| SMILES | COC(=O)[C@]1(C2CC/C(C)=C\CC/C(C)=C\CC[C@@]3(C)O[C@H]3C2)CCN=N1 |
| InChI | InChI=1S/C22H34N2O3/c1-16-7-5-8-17(2)10-11-18(15-19-21(3,27-19)12-6-9-16)22(20(25)26-4)13-14-23-24-22/h8-9,18-19H,5-7,10-15H2,1-4H3/b16-9-,17-8-/t18?,19-,21+,22+/m0/s1 |
| InChIKey | RXNXPTCDRORTMZ-MFKFEBGFSA-N |
| XLogP | 5.16 |
| TPSA | 63.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|