C20H34O3 — CID 23728900
(4Z,8R,10E)-8-(2-hydroxypropan-2-yl)-5,11-dimethylcyclotetradeca-4,10-diene-1-carboxylic acid (PubChem CID 23728900) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (4Z,8R,10E)-8-(2-hydroxypropan-2-yl)-5,11-dimethylcyclotetradeca-4,10-diene-1-carboxylic acid.
| Compound Name | (4Z,8R,10E)-8-(2-hydroxypropan-2-yl)-5,11-dimethylcyclotetradeca-4,10-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 23728900 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (4Z,8R,10E)-8-(2-hydroxypropan-2-yl)-5,11-dimethylcyclotetradeca-4,10-diene-1-carboxylic acid |
| SMILES | C/C1=C/CCC(C(=O)O)CCC/C(C)=C/C[C@H](C(C)(C)O)CC1 |
| InChI | InChI=1S/C20H34O3/c1-15-7-5-9-17(19(21)22)10-6-8-16(2)12-14-18(13-11-15)20(3,4)23/h7,12,17-18,23H,5-6,8-11,13-14H2,1-4H3,(H,21,22)/b15-7-,16-12+/t17?,18-/m1/s1 |
| InChIKey | QMCCXGZMRUVQKN-HTOZKJBLSA-N |
| XLogP | 5.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|