C26H40N8O2 — CID 23729163
3-[[4-[[3-(aminomethyl)cyclohexyl]methylamino]-6-(cyclohexylamino)-1,3,5-triazin-2-yl]amino]-N-methoxy-4-methylbenzamide (PubChem CID 23729163) has the molecular formula C26H40N8O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 3-[[4-[[3-(aminomethyl)cyclohexyl]methylamino]-6-(cyclohexylamino)-1,3,5-triazin-2-yl]amino]-N-methoxy-4-methylbenzamide.
| Compound Name | 3-[[4-[[3-(aminomethyl)cyclohexyl]methylamino]-6-(cyclohexylamino)-1,3,5-triazin-2-yl]amino]-N-methoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 23729163 |
| Molecular Formula | C26H40N8O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | 3-[[4-[[3-(aminomethyl)cyclohexyl]methylamino]-6-(cyclohexylamino)-1,3,5-triazin-2-yl]amino]-N-methoxy-4-methylbenzamide |
| SMILES | CONC(=O)c1ccc(C)c(Nc2nc(NCC3CCCC(CN)C3)nc(NC3CCCCC3)n2)c1 |
| InChI | InChI=1S/C26H40N8O2/c1-17-11-12-20(23(35)34-36-2)14-22(17)30-26-32-24(28-16-19-8-6-7-18(13-19)15-27)31-25(33-26)29-21-9-4-3-5-10-21/h11-12,14,18-19,21H,3-10,13,15-16,27H2,1-2H3,(H,34,35)(H3,28,29,30,31,32,33) |
| InChIKey | JOQUGDNCAGUKRL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|