C34H41ClN8O — CID 23729361
3-[1-[(2-chlorophenyl)methyl]indol-5-yl]-1-[4-[4-(2-ethoxyethyl)piperazin-1-yl]cyclohexyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 23729361) has the molecular formula C34H41ClN8O and a molecular weight of 613.21 g/mol. Its IUPAC name is 3-[1-[(2-chlorophenyl)methyl]indol-5-yl]-1-[4-[4-(2-ethoxyethyl)piperazin-1-yl]cyclohexyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-[1-[(2-chlorophenyl)methyl]indol-5-yl]-1-[4-[4-(2-ethoxyethyl)piperazin-1-yl]cyclohexyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 23729361 |
| Molecular Formula | C34H41ClN8O |
| Molecular Weight | 613.21 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | 3-[1-[(2-chlorophenyl)methyl]indol-5-yl]-1-[4-[4-(2-ethoxyethyl)piperazin-1-yl]cyclohexyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCOCCN1CCN(C2CCC(n3nc(-c4ccc5c(ccn5Cc5ccccc5Cl)c4)c4c(N)ncnc43)CC2)CC1 |
| InChI | InChI=1S/C34H41ClN8O/c1-2-44-20-19-40-15-17-41(18-16-40)27-8-10-28(11-9-27)43-34-31(33(36)37-23-38-34)32(39-43)25-7-12-30-24(21-25)13-14-42(30)22-26-5-3-4-6-29(26)35/h3-7,12-14,21,23,27-28H,2,8-11,15-20,22H2,1H3,(H2,36,37,38) |
| InChIKey | OQFICZNWVBVYLB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.21 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|