C42H86O7Si3 — CID 23729733
ethyl (E,4S,5S,6R,7R,8R,9R,10R)-5,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8-tetramethyl-10-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]undec-2-enoate (PubChem CID 23729733) has the molecular formula C42H86O7Si3 and a molecular weight of 787.40 g/mol. Its IUPAC name is ethyl (E,4S,5S,6R,7R,8R,9R,10R)-5,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8-tetramethyl-10-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]undec-2-enoate.
| Compound Name | ethyl (E,4S,5S,6R,7R,8R,9R,10R)-5,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8-tetramethyl-10-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]undec-2-enoate |
|---|---|
| PubChem CID | 23729733 |
| Molecular Formula | C42H86O7Si3 |
| Molecular Weight | 787.40 g/mol |
| Exact Mass | 786.57 |
| IUPAC Name | ethyl (E,4S,5S,6R,7R,8R,9R,10R)-5,7,9-tris[[tert-butyl(dimethyl)silyl]oxy]-2,4,6,8-tetramethyl-10-[(4R,5R)-2,2,5-trimethyl-1,3-dioxan-4-yl]undec-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H]1OC(C)(C)OC[C@H]1C |
| InChI | InChI=1S/C42H86O7Si3/c1-25-44-38(43)29(3)26-28(2)35(47-50(19,20)39(8,9)10)32(6)37(49-52(23,24)41(14,15)16)33(7)36(48-51(21,22)40(11,12)13)31(5)34-30(4)27-45-42(17,18)46-34/h26,28,30-37H,25,27H2,1-24H3/b29-26+/t28-,30+,31+,32+,33+,34+,35-,36+,37+/m0/s1 |
| InChIKey | VVCVMHVKPWKLBM-AAIPXVEMSA-N |
| XLogP | 12.00 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.40 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|