About (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol
(2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol (PubChem CID 23729843) has the molecular formula C8H14OS2
and a molecular weight of 190.33 g/mol. Its IUPAC name is (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol.
Molecular Properties
| Compound Name | (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol |
| PubChem CID | 23729843 |
| Molecular Formula | C8H14OS2 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol |
| SMILES | C=C[C@@H](O)CC1SCCCS1 |
| InChI | InChI=1S/C8H14OS2/c1-2-7(9)6-8-10-4-3-5-11-8/h2,7-9H,1,3-6H2/t7-/m1/s1 |
| InChIKey | GHNZLERVZXHDFH-SSDOTTSWSA-N |
| XLogP | 2.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol?
The IUPAC name of (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol (CID 23729843) is (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol.
What is the SMILES notation for (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol?
The canonical SMILES for (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol is C=C[C@@H](O)CC1SCCCS1.
What is the InChIKey of (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol?
The InChIKey is GHNZLERVZXHDFH-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H14OS2/c1-2-7(9)6-8-10-4-3-5-11-8/h2,7-9H,1,3-6H2/t7-/m1/s1.
What are the key properties of (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol?
(2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol has a molecular weight of 190.33 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-(1,3-dithian-2-yl)but-3-en-2-ol is sourced from PubChem (CID 23729843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).