C26H34Cl4N4O2 — CID 23730145
2-[[2-[6-aminohexyl-[2-(2,4-dichlorophenyl)ethyl]amino]acetyl]-[2-(2,4-dichlorophenyl)ethyl]amino]acetamide (PubChem CID 23730145) has the molecular formula C26H34Cl4N4O2 and a molecular weight of 576.40 g/mol. Its IUPAC name is 2-[[2-[6-aminohexyl-[2-(2,4-dichlorophenyl)ethyl]amino]acetyl]-[2-(2,4-dichlorophenyl)ethyl]amino]acetamide.
| Compound Name | 2-[[2-[6-aminohexyl-[2-(2,4-dichlorophenyl)ethyl]amino]acetyl]-[2-(2,4-dichlorophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 23730145 |
| Molecular Formula | C26H34Cl4N4O2 |
| Molecular Weight | 576.40 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | 2-[[2-[6-aminohexyl-[2-(2,4-dichlorophenyl)ethyl]amino]acetyl]-[2-(2,4-dichlorophenyl)ethyl]amino]acetamide |
| SMILES | NCCCCCCN(CCc1ccc(Cl)cc1Cl)CC(=O)N(CCc1ccc(Cl)cc1Cl)CC(N)=O |
| InChI | InChI=1S/C26H34Cl4N4O2/c27-21-7-5-19(23(29)15-21)9-13-33(12-4-2-1-3-11-31)18-26(36)34(17-25(32)35)14-10-20-6-8-22(28)16-24(20)30/h5-8,15-16H,1-4,9-14,17-18,31H2,(H2,32,35) |
| InChIKey | UXALQPRPQYILAB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|