C24H48O6Si2 — CID 23730193
methyl 2-[(2R,3R,5S,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(2S)-4-oxobutan-2-yl]oxan-2-yl]acetate (PubChem CID 23730193) has the molecular formula C24H48O6Si2 and a molecular weight of 488.81 g/mol. Its IUPAC name is methyl 2-[(2R,3R,5S,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(2S)-4-oxobutan-2-yl]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,5S,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(2S)-4-oxobutan-2-yl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 23730193 |
| Molecular Formula | C24H48O6Si2 |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | methyl 2-[(2R,3R,5S,6S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(2S)-4-oxobutan-2-yl]oxan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1O[C@@H]([C@@H](C)CC=O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O6Si2/c1-17(13-14-25)22-20(30-32(11,12)24(5,6)7)15-19(18(28-22)16-21(26)27-8)29-31(9,10)23(2,3)4/h14,17-20,22H,13,15-16H2,1-12H3/t17-,18+,19+,20-,22-/m0/s1 |
| InChIKey | MBURBHBADWMHHK-MOFJNDHNSA-N |
| XLogP | 5.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|